C15H18FN3O4 — CID 95173124
methyl N-[5-[[(3R)-1-ethyl-5-oxopyrrolidine-3-carbonyl]amino]-2-fluorophenyl]carbamate (PubChem CID 95173124) has the molecular formula C15H18FN3O4 and a molecular weight of 323.32 g/mol. Its IUPAC name is methyl N-[5-[[(3R)-1-ethyl-5-oxopyrrolidine-3-carbonyl]amino]-2-fluorophenyl]carbamate.
| Compound Name | methyl N-[5-[[(3R)-1-ethyl-5-oxopyrrolidine-3-carbonyl]amino]-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 95173124 |
| Molecular Formula | C15H18FN3O4 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | methyl N-[5-[[(3R)-1-ethyl-5-oxopyrrolidine-3-carbonyl]amino]-2-fluorophenyl]carbamate |
| SMILES | CCN1C[C@H](C(=O)Nc2ccc(F)c(NC(=O)OC)c2)CC1=O |
| InChI | InChI=1S/C15H18FN3O4/c1-3-19-8-9(6-13(19)20)14(21)17-10-4-5-11(16)12(7-10)18-15(22)23-2/h4-5,7,9H,3,6,8H2,1-2H3,(H,17,21)(H,18,22)/t9-/m1/s1 |
| InChIKey | LALOYAJZUPHTFI-SECBINFHSA-N |
| XLogP | 1.81 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |