C17H22N2O — CID 95173136
(2R,4R)-1-[(1R)-cyclohex-2-en-1-yl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide (PubChem CID 95173136) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (2R,4R)-1-[(1R)-cyclohex-2-en-1-yl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide.
| Compound Name | (2R,4R)-1-[(1R)-cyclohex-2-en-1-yl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 95173136 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (2R,4R)-1-[(1R)-cyclohex-2-en-1-yl]-2-methyl-3,4-dihydro-2H-quinoline-4-carboxamide |
| SMILES | C[C@@H]1C[C@@H](C(N)=O)c2ccccc2N1[C@H]1C=CCCC1 |
| InChI | InChI=1S/C17H22N2O/c1-12-11-15(17(18)20)14-9-5-6-10-16(14)19(12)13-7-3-2-4-8-13/h3,5-7,9-10,12-13,15H,2,4,8,11H2,1H3,(H2,18,20)/t12-,13+,15-/m1/s1 |
| InChIKey | OZHJEQNXOYHBRT-VNHYZAJKSA-N |
| XLogP | 2.96 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|