C20H19NO4 — CID 95173403
[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl] 2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxylate (PubChem CID 95173403) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is [(1S)-1,2,3,4-tetrahydronaphthalen-1-yl] 2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | [(1S)-1,2,3,4-tetrahydronaphthalen-1-yl] 2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 95173403 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [(1S)-1,2,3,4-tetrahydronaphthalen-1-yl] 2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carboxylate |
| SMILES | O=C1CCCc2[nH]c(=O)c(C(=O)O[C@H]3CCCc4ccccc43)cc21 |
| InChI | InChI=1S/C20H19NO4/c22-17-9-4-8-16-14(17)11-15(19(23)21-16)20(24)25-18-10-3-6-12-5-1-2-7-13(12)18/h1-2,5,7,11,18H,3-4,6,8-10H2,(H,21,23)/t18-/m0/s1 |
| InChIKey | UHXBXJVGBARKHW-SFHVURJKSA-N |
| XLogP | 3.13 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |