About methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate
methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate (PubChem CID 95173523) has the molecular formula C16H19N3O5
and a molecular weight of 333.34 g/mol. Its IUPAC name is methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate |
| PubChem CID | 95173523 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn([C@H]2CCCC[C@H]2OC(=O)c2ccoc2C)nn1 |
| InChI | InChI=1S/C16H19N3O5/c1-10-11(7-8-23-10)15(20)24-14-6-4-3-5-13(14)19-9-12(17-18-19)16(21)22-2/h7-9,13-14H,3-6H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | AXVDAPOPXXUWGM-UONOGXRCSA-N |
| XLogP | 2.31 |
| TPSA | 96.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate?
The IUPAC name of methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate (CID 95173523) is methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate.
What is the SMILES notation for methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate?
The canonical SMILES for methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate is COC(=O)c1cn([C@H]2CCCC[C@H]2OC(=O)c2ccoc2C)nn1.
What is the InChIKey of methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate?
The InChIKey is AXVDAPOPXXUWGM-UONOGXRCSA-N. The full InChI is InChI=1S/C16H19N3O5/c1-10-11(7-8-23-10)15(20)24-14-6-4-3-5-13(14)19-9-12(17-18-19)16(21)22-2/h7-9,13-14H,3-6H2,1-2H3/t13-,14+/m0/s1.
What are the key properties of methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate?
methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate has a molecular weight of 333.34 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(1S,2R)-2-(2-methylfuran-3-carbonyl)oxycyclohexyl]triazole-4-carboxylate is sourced from PubChem (CID 95173523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).