C11H13N3O5S — CID 95174309
(4S)-N,N-dimethyl-3-(5-nitrofuran-2-carbonyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 95174309) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is (4S)-N,N-dimethyl-3-(5-nitrofuran-2-carbonyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-N,N-dimethyl-3-(5-nitrofuran-2-carbonyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 95174309 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (4S)-N,N-dimethyl-3-(5-nitrofuran-2-carbonyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CSCN1C(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H13N3O5S/c1-12(2)10(15)7-5-20-6-13(7)11(16)8-3-4-9(19-8)14(17)18/h3-4,7H,5-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | YRUOVUULEUNXAD-SSDOTTSWSA-N |
| XLogP | 0.79 |
| TPSA | 96.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|