About [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate
[(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate (PubChem CID 95174688) has the molecular formula C18H25N5O2
and a molecular weight of 343.43 g/mol. Its IUPAC name is [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate.
Molecular Properties
| Compound Name | [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate |
| PubChem CID | 95174688 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate |
| SMILES | Cc1cc(N2CCC[C@@H](OC(=O)CCc3cnn(C)c3)C2)nc(C)n1 |
| InChI | InChI=1S/C18H25N5O2/c1-13-9-17(21-14(2)20-13)23-8-4-5-16(12-23)25-18(24)7-6-15-10-19-22(3)11-15/h9-11,16H,4-8,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | JIEOCWAVKCKMJB-MRXNPFEDSA-N |
| XLogP | 1.97 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate?
The IUPAC name of [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate (CID 95174688) is [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate.
What is the SMILES notation for [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate?
The canonical SMILES for [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate is Cc1cc(N2CCC[C@@H](OC(=O)CCc3cnn(C)c3)C2)nc(C)n1.
What is the InChIKey of [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate?
The InChIKey is JIEOCWAVKCKMJB-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H25N5O2/c1-13-9-17(21-14(2)20-13)23-8-4-5-16(12-23)25-18(24)7-6-15-10-19-22(3)11-15/h9-11,16H,4-8,12H2,1-3H3/t16-/m1/s1.
What are the key properties of [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate?
[(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate has a molecular weight of 343.43 g/mol, XLogP of 1.97, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-(2,6-dimethylpyrimidin-4-yl)piperidin-3-yl] 3-(1-methylpyrazol-4-yl)propanoate is sourced from PubChem (CID 95174688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).