C20H22N2O3 — CID 95174970
methyl 6-[(4R)-4-phenylazepane-1-carbonyl]pyridine-2-carboxylate (PubChem CID 95174970) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is methyl 6-[(4R)-4-phenylazepane-1-carbonyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[(4R)-4-phenylazepane-1-carbonyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 95174970 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | methyl 6-[(4R)-4-phenylazepane-1-carbonyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(C(=O)N2CCC[C@@H](c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C20H22N2O3/c1-25-20(24)18-11-5-10-17(21-18)19(23)22-13-6-9-16(12-14-22)15-7-3-2-4-8-15/h2-5,7-8,10-11,16H,6,9,12-14H2,1H3/t16-/m1/s1 |
| InChIKey | CHSWBYWHNYMZGX-MRXNPFEDSA-N |
| XLogP | 3.28 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |