C18H19N3O4 — CID 95177190
4-amino-N-[[(1R)-1-hydroxy-3,4-dihydro-2H-naphthalen-1-yl]methyl]-3-nitrobenzamide (PubChem CID 95177190) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-amino-N-[[(1R)-1-hydroxy-3,4-dihydro-2H-naphthalen-1-yl]methyl]-3-nitrobenzamide.
| Compound Name | 4-amino-N-[[(1R)-1-hydroxy-3,4-dihydro-2H-naphthalen-1-yl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 95177190 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-amino-N-[[(1R)-1-hydroxy-3,4-dihydro-2H-naphthalen-1-yl]methyl]-3-nitrobenzamide |
| SMILES | Nc1ccc(C(=O)NC[C@@]2(O)CCCc3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O4/c19-15-8-7-13(10-16(15)21(24)25)17(22)20-11-18(23)9-3-5-12-4-1-2-6-14(12)18/h1-2,4,6-8,10,23H,3,5,9,11,19H2,(H,20,22)/t18-/m0/s1 |
| InChIKey | PFXKNPSUCRZRRT-SFHVURJKSA-N |
| XLogP | 2.13 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|