C10H18N4O2S — CID 95179138
(2S)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2-methoxypropanamide (PubChem CID 95179138) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is (2S)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2-methoxypropanamide.
| Compound Name | (2S)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2-methoxypropanamide |
|---|---|
| PubChem CID | 95179138 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (2S)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2-methoxypropanamide |
| SMILES | CCn1c(CCNC(=O)[C@H](C)OC)n[nH]c1=S |
| InChI | InChI=1S/C10H18N4O2S/c1-4-14-8(12-13-10(14)17)5-6-11-9(15)7(2)16-3/h7H,4-6H2,1-3H3,(H,11,15)(H,13,17)/t7-/m0/s1 |
| InChIKey | KXBJHXVSQQEAFB-ZETCQYMHSA-N |
| XLogP | 0.65 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|