C12H12BrN3O — CID 95179696
(2S)-2-[(5-bromopyrimidin-2-yl)amino]-2-phenylethanol (PubChem CID 95179696) has the molecular formula C12H12BrN3O and a molecular weight of 294.15 g/mol. Its IUPAC name is (2S)-2-[(5-bromopyrimidin-2-yl)amino]-2-phenylethanol.
| Compound Name | (2S)-2-[(5-bromopyrimidin-2-yl)amino]-2-phenylethanol |
|---|---|
| PubChem CID | 95179696 |
| Molecular Formula | C12H12BrN3O |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | (2S)-2-[(5-bromopyrimidin-2-yl)amino]-2-phenylethanol |
| SMILES | OC[C@@H](Nc1ncc(Br)cn1)c1ccccc1 |
| InChI | InChI=1S/C12H12BrN3O/c13-10-6-14-12(15-7-10)16-11(8-17)9-4-2-1-3-5-9/h1-7,11,17H,8H2,(H,14,15,16)/t11-/m1/s1 |
| InChIKey | IHMKIIVWOZPYKE-LLVKDONJSA-N |
| XLogP | 2.38 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |