C13H26N2O3S — CID 95180129
N-(2-sulfamoylethyl)-2-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide (PubChem CID 95180129) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is N-(2-sulfamoylethyl)-2-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide.
| Compound Name | N-(2-sulfamoylethyl)-2-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 95180129 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-(2-sulfamoylethyl)-2-[(1S,5R)-3,3,5-trimethylcyclohexyl]acetamide |
| SMILES | C[C@@H]1C[C@H](CC(=O)NCCS(N)(=O)=O)CC(C)(C)C1 |
| InChI | InChI=1S/C13H26N2O3S/c1-10-6-11(9-13(2,3)8-10)7-12(16)15-4-5-19(14,17)18/h10-11H,4-9H2,1-3H3,(H,15,16)(H2,14,17,18)/t10-,11-/m1/s1 |
| InChIKey | VOHGYNFDRQZONT-GHMZBOCLSA-N |
| XLogP | 1.24 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |