C19H26F2N2O4 — CID 95187138
(2R)-2-(3,4-difluorophenyl)-N-[3-[[(2S)-oxolan-2-yl]methoxy]propyl]morpholine-4-carboxamide (PubChem CID 95187138) has the molecular formula C19H26F2N2O4 and a molecular weight of 384.42 g/mol. Its IUPAC name is (2R)-2-(3,4-difluorophenyl)-N-[3-[[(2S)-oxolan-2-yl]methoxy]propyl]morpholine-4-carboxamide.
| Compound Name | (2R)-2-(3,4-difluorophenyl)-N-[3-[[(2S)-oxolan-2-yl]methoxy]propyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 95187138 |
| Molecular Formula | C19H26F2N2O4 |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (2R)-2-(3,4-difluorophenyl)-N-[3-[[(2S)-oxolan-2-yl]methoxy]propyl]morpholine-4-carboxamide |
| SMILES | O=C(NCCCOC[C@@H]1CCCO1)N1CCO[C@H](c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C19H26F2N2O4/c20-16-5-4-14(11-17(16)21)18-12-23(7-10-27-18)19(24)22-6-2-8-25-13-15-3-1-9-26-15/h4-5,11,15,18H,1-3,6-10,12-13H2,(H,22,24)/t15-,18-/m0/s1 |
| InChIKey | IAMMHRUUABHWTQ-YJBOKZPZSA-N |
| XLogP | 2.63 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|