About N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide
N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide (PubChem CID 95187916) has the molecular formula C16H16FN3O2
and a molecular weight of 301.32 g/mol. Its IUPAC name is N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide.
Molecular Properties
| Compound Name | N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide |
| PubChem CID | 95187916 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide |
| SMILES | C[C@@H](c1ccncc1)N(C)C(=O)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C16H16FN3O2/c1-11(12-6-8-18-9-7-12)20(2)16(22)15(21)19-14-5-3-4-13(17)10-14/h3-11H,1-2H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | AVYKGZAWEGSTOU-NSHDSACASA-N |
| XLogP | 2.38 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide?
The IUPAC name of N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide (CID 95187916) is N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide.
What is the SMILES notation for N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide?
The canonical SMILES for N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide is C[C@@H](c1ccncc1)N(C)C(=O)C(=O)Nc1cccc(F)c1.
What is the InChIKey of N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide?
The InChIKey is AVYKGZAWEGSTOU-NSHDSACASA-N. The full InChI is InChI=1S/C16H16FN3O2/c1-11(12-6-8-18-9-7-12)20(2)16(22)15(21)19-14-5-3-4-13(17)10-14/h3-11H,1-2H3,(H,19,21)/t11-/m0/s1.
What are the key properties of N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide?
N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide has a molecular weight of 301.32 g/mol, XLogP of 2.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorophenyl)-N'-methyl-N'-[(1S)-1-pyridin-4-ylethyl]oxamide is sourced from PubChem (CID 95187916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).