C19H26N4O — CID 95187927
(1R)-1-pyridin-3-yl-2-[4-[(2,6,6-trimethylcyclohexen-1-yl)methyl]triazol-1-yl]ethanol (PubChem CID 95187927) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is (1R)-1-pyridin-3-yl-2-[4-[(2,6,6-trimethylcyclohexen-1-yl)methyl]triazol-1-yl]ethanol.
| Compound Name | (1R)-1-pyridin-3-yl-2-[4-[(2,6,6-trimethylcyclohexen-1-yl)methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 95187927 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (1R)-1-pyridin-3-yl-2-[4-[(2,6,6-trimethylcyclohexen-1-yl)methyl]triazol-1-yl]ethanol |
| SMILES | CC1=C(Cc2cn(C[C@H](O)c3cccnc3)nn2)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H26N4O/c1-14-6-4-8-19(2,3)17(14)10-16-12-23(22-21-16)13-18(24)15-7-5-9-20-11-15/h5,7,9,11-12,18,24H,4,6,8,10,13H2,1-3H3/t18-/m0/s1 |
| InChIKey | BXACWCUECFMXGE-SFHVURJKSA-N |
| XLogP | 3.48 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|