C17H17N3O3S — CID 95191213
2,2-dioxo-N-[(1S,2R)-2-phenylcyclopropyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 95191213) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 2,2-dioxo-N-[(1S,2R)-2-phenylcyclopropyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | 2,2-dioxo-N-[(1S,2R)-2-phenylcyclopropyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 95191213 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2,2-dioxo-N-[(1S,2R)-2-phenylcyclopropyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | O=C(N[C@H]1C[C@@H]1c1ccccc1)C1=CN2CCS(=O)(=O)N=C2C=C1 |
| InChI | InChI=1S/C17H17N3O3S/c21-17(18-15-10-14(15)12-4-2-1-3-5-12)13-6-7-16-19-24(22,23)9-8-20(16)11-13/h1-7,11,14-15H,8-10H2,(H,18,21)/t14-,15+/m1/s1 |
| InChIKey | JVUNMFAWSWIITL-CABCVRRESA-N |
| XLogP | 1.16 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |