C18H27N3O3 — CID 95192416
N'-[[(3S)-1-[(2-methoxy-3,5-dimethylphenyl)methyl]piperidin-3-yl]methyl]oxamide (PubChem CID 95192416) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is N'-[[(3S)-1-[(2-methoxy-3,5-dimethylphenyl)methyl]piperidin-3-yl]methyl]oxamide.
| Compound Name | N'-[[(3S)-1-[(2-methoxy-3,5-dimethylphenyl)methyl]piperidin-3-yl]methyl]oxamide |
|---|---|
| PubChem CID | 95192416 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N'-[[(3S)-1-[(2-methoxy-3,5-dimethylphenyl)methyl]piperidin-3-yl]methyl]oxamide |
| SMILES | COc1c(C)cc(C)cc1CN1CCC[C@@H](CNC(=O)C(N)=O)C1 |
| InChI | InChI=1S/C18H27N3O3/c1-12-7-13(2)16(24-3)15(8-12)11-21-6-4-5-14(10-21)9-20-18(23)17(19)22/h7-8,14H,4-6,9-11H2,1-3H3,(H2,19,22)(H,20,23)/t14-/m0/s1 |
| InChIKey | DRGHDKGVPJEVFH-AWEZNQCLSA-N |
| XLogP | 1.13 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|