C17H20FN3O4 — CID 95192852
methyl N-[5-[[2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-2-oxoacetyl]amino]-2-fluorophenyl]carbamate (PubChem CID 95192852) has the molecular formula C17H20FN3O4 and a molecular weight of 349.36 g/mol. Its IUPAC name is methyl N-[5-[[2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-2-oxoacetyl]amino]-2-fluorophenyl]carbamate.
| Compound Name | methyl N-[5-[[2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-2-oxoacetyl]amino]-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 95192852 |
| Molecular Formula | C17H20FN3O4 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | methyl N-[5-[[2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-2-oxoacetyl]amino]-2-fluorophenyl]carbamate |
| SMILES | COC(=O)Nc1cc(NC(=O)C(=O)NC[C@H]2CC=CCC2)ccc1F |
| InChI | InChI=1S/C17H20FN3O4/c1-25-17(24)21-14-9-12(7-8-13(14)18)20-16(23)15(22)19-10-11-5-3-2-4-6-11/h2-3,7-9,11H,4-6,10H2,1H3,(H,19,22)(H,20,23)(H,21,24)/t11-/m0/s1 |
| InChIKey | JUWOSZRRXBXKSC-NSHDSACASA-N |
| XLogP | 2.41 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|