C16H18FN3O3S — CID 95195829
(2R)-2-(2-fluoro-N-methylsulfonylanilino)-N-pyridin-3-ylbutanamide (PubChem CID 95195829) has the molecular formula C16H18FN3O3S and a molecular weight of 351.40 g/mol. Its IUPAC name is (2R)-2-(2-fluoro-N-methylsulfonylanilino)-N-pyridin-3-ylbutanamide.
| Compound Name | (2R)-2-(2-fluoro-N-methylsulfonylanilino)-N-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 95195829 |
| Molecular Formula | C16H18FN3O3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (2R)-2-(2-fluoro-N-methylsulfonylanilino)-N-pyridin-3-ylbutanamide |
| SMILES | CC[C@H](C(=O)Nc1cccnc1)N(c1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C16H18FN3O3S/c1-3-14(16(21)19-12-7-6-10-18-11-12)20(24(2,22)23)15-9-5-4-8-13(15)17/h4-11,14H,3H2,1-2H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | FRWLQDTYJIVDTN-CQSZACIVSA-N |
| XLogP | 2.40 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |