C16H20F2N2O2 — CID 95196086
(2R)-1-(3,4-difluorobenzoyl)-N,N-diethylpyrrolidine-2-carboxamide (PubChem CID 95196086) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is (2R)-1-(3,4-difluorobenzoyl)-N,N-diethylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(3,4-difluorobenzoyl)-N,N-diethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95196086 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2R)-1-(3,4-difluorobenzoyl)-N,N-diethylpyrrolidine-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1CCCN1C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H20F2N2O2/c1-3-19(4-2)16(22)14-6-5-9-20(14)15(21)11-7-8-12(17)13(18)10-11/h7-8,10,14H,3-6,9H2,1-2H3/t14-/m1/s1 |
| InChIKey | KWZIUMOEGZJYTH-CQSZACIVSA-N |
| XLogP | 2.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |