About (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol
(4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol (PubChem CID 95196945) has the molecular formula C11H23NO2S2
and a molecular weight of 265.44 g/mol. Its IUPAC name is (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol.
Molecular Properties
| Compound Name | (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol |
| PubChem CID | 95196945 |
| Molecular Formula | C11H23NO2S2 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol |
| SMILES | C[C@](O)(CCCO)CNC1CSCCSC1 |
| InChI | InChI=1S/C11H23NO2S2/c1-11(14,3-2-4-13)9-12-10-7-15-5-6-16-8-10/h10,12-14H,2-9H2,1H3/t11-/m0/s1 |
| InChIKey | NAYRSVHJRKMYMN-NSHDSACASA-N |
| XLogP | 0.95 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol?
The IUPAC name of (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol (CID 95196945) is (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol.
What is the SMILES notation for (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol?
The canonical SMILES for (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol is C[C@](O)(CCCO)CNC1CSCCSC1.
What is the InChIKey of (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol?
The InChIKey is NAYRSVHJRKMYMN-NSHDSACASA-N. The full InChI is InChI=1S/C11H23NO2S2/c1-11(14,3-2-4-13)9-12-10-7-15-5-6-16-8-10/h10,12-14H,2-9H2,1H3/t11-/m0/s1.
What are the key properties of (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol?
(4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol has a molecular weight of 265.44 g/mol, XLogP of 0.95, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5-(1,4-dithiepan-6-ylamino)-4-methylpentane-1,4-diol is sourced from PubChem (CID 95196945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).