C21H28N6O — CID 95197148
1-methyl-N-[(1R)-3-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)butyl]indole-3-carboxamide (PubChem CID 95197148) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is 1-methyl-N-[(1R)-3-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)butyl]indole-3-carboxamide.
| Compound Name | 1-methyl-N-[(1R)-3-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)butyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 95197148 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 1-methyl-N-[(1R)-3-methyl-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl)butyl]indole-3-carboxamide |
| SMILES | CC(C)C[C@@H](NC(=O)c1cn(C)c2ccccc12)c1nnc2n1CCNCC2 |
| InChI | InChI=1S/C21H28N6O/c1-14(2)12-17(20-25-24-19-8-9-22-10-11-27(19)20)23-21(28)16-13-26(3)18-7-5-4-6-15(16)18/h4-7,13-14,17,22H,8-12H2,1-3H3,(H,23,28)/t17-/m1/s1 |
| InChIKey | GKCOQMAPUACFSJ-QGZVFWFLSA-N |
| XLogP | 2.43 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |