C15H20N2O3 — CID 95197684
(3R)-1,3-dimethyl-4-(2-phenylmethoxyacetyl)piperazin-2-one (PubChem CID 95197684) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is (3R)-1,3-dimethyl-4-(2-phenylmethoxyacetyl)piperazin-2-one.
| Compound Name | (3R)-1,3-dimethyl-4-(2-phenylmethoxyacetyl)piperazin-2-one |
|---|---|
| PubChem CID | 95197684 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (3R)-1,3-dimethyl-4-(2-phenylmethoxyacetyl)piperazin-2-one |
| SMILES | C[C@@H]1C(=O)N(C)CCN1C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O3/c1-12-15(19)16(2)8-9-17(12)14(18)11-20-10-13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | FELQYAXJWDFVCP-GFCCVEGCSA-N |
| XLogP | 0.89 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |