C22H31N3O — CID 95197853
[(3R)-3-(3-phenylpropyl)-1-(6-propan-2-ylpyrimidin-4-yl)piperidin-3-yl]methanol (PubChem CID 95197853) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is [(3R)-3-(3-phenylpropyl)-1-(6-propan-2-ylpyrimidin-4-yl)piperidin-3-yl]methanol.
| Compound Name | [(3R)-3-(3-phenylpropyl)-1-(6-propan-2-ylpyrimidin-4-yl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 95197853 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | [(3R)-3-(3-phenylpropyl)-1-(6-propan-2-ylpyrimidin-4-yl)piperidin-3-yl]methanol |
| SMILES | CC(C)c1cc(N2CCC[C@](CO)(CCCc3ccccc3)C2)ncn1 |
| InChI | InChI=1S/C22H31N3O/c1-18(2)20-14-21(24-17-23-20)25-13-7-12-22(15-25,16-26)11-6-10-19-8-4-3-5-9-19/h3-5,8-9,14,17-18,26H,6-7,10-13,15-16H2,1-2H3/t22-/m1/s1 |
| InChIKey | STRSXNKMFGHYMY-JOCHJYFZSA-N |
| XLogP | 4.20 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |