C13H17N3O4S — CID 95198052
4-[(2R)-2,4-dimethyl-3-oxopiperazine-1-carbonyl]benzenesulfonamide (PubChem CID 95198052) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 4-[(2R)-2,4-dimethyl-3-oxopiperazine-1-carbonyl]benzenesulfonamide.
| Compound Name | 4-[(2R)-2,4-dimethyl-3-oxopiperazine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 95198052 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-[(2R)-2,4-dimethyl-3-oxopiperazine-1-carbonyl]benzenesulfonamide |
| SMILES | C[C@@H]1C(=O)N(C)CCN1C(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H17N3O4S/c1-9-12(17)15(2)7-8-16(9)13(18)10-3-5-11(6-4-10)21(14,19)20/h3-6,9H,7-8H2,1-2H3,(H2,14,19,20)/t9-/m1/s1 |
| InChIKey | NBGARSZCCQDEIF-SECBINFHSA-N |
| XLogP | -0.36 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |