C16H20F3N3O — CID 95199125
N-[[(3R)-1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrrolidin-3-yl]methyl]but-3-enamide (PubChem CID 95199125) has the molecular formula C16H20F3N3O and a molecular weight of 327.35 g/mol. Its IUPAC name is N-[[(3R)-1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrrolidin-3-yl]methyl]but-3-enamide.
| Compound Name | N-[[(3R)-1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrrolidin-3-yl]methyl]but-3-enamide |
|---|---|
| PubChem CID | 95199125 |
| Molecular Formula | C16H20F3N3O |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[[(3R)-1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrrolidin-3-yl]methyl]but-3-enamide |
| SMILES | C=CCC(=O)NC[C@H]1CCN(Cc2ccc(C(F)(F)F)nc2)C1 |
| InChI | InChI=1S/C16H20F3N3O/c1-2-3-15(23)21-9-13-6-7-22(11-13)10-12-4-5-14(20-8-12)16(17,18)19/h2,4-5,8,13H,1,3,6-7,9-11H2,(H,21,23)/t13-/m1/s1 |
| InChIKey | NQMRULLKQKNMSC-CYBMUJFWSA-N |
| XLogP | 2.61 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|