C15H20N6O2S — CID 95199390
(9aR)-8-methyl-2-[[5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-yl]methyl]-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one (PubChem CID 95199390) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is (9aR)-8-methyl-2-[[5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-yl]methyl]-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one.
| Compound Name | (9aR)-8-methyl-2-[[5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-yl]methyl]-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 95199390 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (9aR)-8-methyl-2-[[5-(1H-1,2,4-triazol-5-ylsulfanyl)furan-2-yl]methyl]-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
| SMILES | CN1CCN2CCN(Cc3ccc(Sc4ncn[nH]4)o3)C[C@@H]2C1=O |
| InChI | InChI=1S/C15H20N6O2S/c1-19-4-6-21-7-5-20(9-12(21)14(19)22)8-11-2-3-13(23-11)24-15-16-10-17-18-15/h2-3,10,12H,4-9H2,1H3,(H,16,17,18)/t12-/m1/s1 |
| InChIKey | UVIVEBIJUXJVKS-GFCCVEGCSA-N |
| XLogP | 0.51 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |