About 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole
5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole (PubChem CID 95199657) has the molecular formula C18H18N6O
and a molecular weight of 334.38 g/mol. Its IUPAC name is 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole.
Molecular Properties
| Compound Name | 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole |
| PubChem CID | 95199657 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole |
| SMILES | Cc1cc(-c2c(-c3ccccc3)ncn2[C@@H](C)c2nn[nH]n2)oc1C |
| InChI | InChI=1S/C18H18N6O/c1-11-9-15(25-13(11)3)17-16(14-7-5-4-6-8-14)19-10-24(17)12(2)18-20-22-23-21-18/h4-10,12H,1-3H3,(H,20,21,22,23)/t12-/m0/s1 |
| InChIKey | JEBAEERJDRYGBY-LBPRGKRZSA-N |
| XLogP | 3.55 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole?
The IUPAC name of 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole (CID 95199657) is 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole.
What is the SMILES notation for 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole?
The canonical SMILES for 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole is Cc1cc(-c2c(-c3ccccc3)ncn2[C@@H](C)c2nn[nH]n2)oc1C.
What is the InChIKey of 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole?
The InChIKey is JEBAEERJDRYGBY-LBPRGKRZSA-N. The full InChI is InChI=1S/C18H18N6O/c1-11-9-15(25-13(11)3)17-16(14-7-5-4-6-8-14)19-10-24(17)12(2)18-20-22-23-21-18/h4-10,12H,1-3H3,(H,20,21,22,23)/t12-/m0/s1.
What are the key properties of 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole?
5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole has a molecular weight of 334.38 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S)-1-[5-(4,5-dimethylfuran-2-yl)-4-phenylimidazol-1-yl]ethyl]-2H-tetrazole is sourced from PubChem (CID 95199657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).