C19H24N4O2 — CID 95200329
furan-2-yl-[(4S)-4-(1-propyl-3,6-dihydro-2H-pyridin-5-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone (PubChem CID 95200329) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is furan-2-yl-[(4S)-4-(1-propyl-3,6-dihydro-2H-pyridin-5-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone.
| Compound Name | furan-2-yl-[(4S)-4-(1-propyl-3,6-dihydro-2H-pyridin-5-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 95200329 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | furan-2-yl-[(4S)-4-(1-propyl-3,6-dihydro-2H-pyridin-5-yl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methanone |
| SMILES | CCCN1CCC=C([C@H]2c3nc[nH]c3CCN2C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C19H24N4O2/c1-2-8-22-9-3-5-14(12-22)18-17-15(20-13-21-17)7-10-23(18)19(24)16-6-4-11-25-16/h4-6,11,13,18H,2-3,7-10,12H2,1H3,(H,20,21)/t18-/m0/s1 |
| InChIKey | GMNYWDIEZMAXRV-SFHVURJKSA-N |
| XLogP | 2.78 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|