C14H15ClN4 — CID 95200424
1-(4-chloro-2-methylphenyl)-5-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-3-methyl-1,2,4-triazole (PubChem CID 95200424) has the molecular formula C14H15ClN4 and a molecular weight of 274.75 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-5-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-3-methyl-1,2,4-triazole.
| Compound Name | 1-(4-chloro-2-methylphenyl)-5-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-3-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 95200424 |
| Molecular Formula | C14H15ClN4 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-5-[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-3-methyl-1,2,4-triazole |
| SMILES | Cc1nc([C@@H]2C=CCN2)n(-c2ccc(Cl)cc2C)n1 |
| InChI | InChI=1S/C14H15ClN4/c1-9-8-11(15)5-6-13(9)19-14(17-10(2)18-19)12-4-3-7-16-12/h3-6,8,12,16H,7H2,1-2H3/t12-/m0/s1 |
| InChIKey | GETSAYXWDGMBJP-LBPRGKRZSA-N |
| XLogP | 2.74 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|