C17H26FN3O — CID 95200536
N-(2-fluoro-4-methylphenyl)-2-[[(2R)-1-piperidin-1-ylpropan-2-yl]amino]acetamide (PubChem CID 95200536) has the molecular formula C17H26FN3O and a molecular weight of 307.41 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-2-[[(2R)-1-piperidin-1-ylpropan-2-yl]amino]acetamide.
| Compound Name | N-(2-fluoro-4-methylphenyl)-2-[[(2R)-1-piperidin-1-ylpropan-2-yl]amino]acetamide |
|---|---|
| PubChem CID | 95200536 |
| Molecular Formula | C17H26FN3O |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-2-[[(2R)-1-piperidin-1-ylpropan-2-yl]amino]acetamide |
| SMILES | Cc1ccc(NC(=O)CN[C@H](C)CN2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C17H26FN3O/c1-13-6-7-16(15(18)10-13)20-17(22)11-19-14(2)12-21-8-4-3-5-9-21/h6-7,10,14,19H,3-5,8-9,11-12H2,1-2H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | LNNWEYNIYFPBMS-CQSZACIVSA-N |
| XLogP | 2.54 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |