C19H27N5O2 — CID 95201446
[6-(3-hydroxypropylamino)-3-pyridinyl]-[(2R)-2-(2-pyrazol-1-ylethyl)piperidin-1-yl]methanone (PubChem CID 95201446) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is [6-(3-hydroxypropylamino)-3-pyridinyl]-[(2R)-2-(2-pyrazol-1-ylethyl)piperidin-1-yl]methanone.
| Compound Name | [6-(3-hydroxypropylamino)-3-pyridinyl]-[(2R)-2-(2-pyrazol-1-ylethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95201446 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | [6-(3-hydroxypropylamino)-3-pyridinyl]-[(2R)-2-(2-pyrazol-1-ylethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(NCCCO)nc1)N1CCCC[C@@H]1CCn1cccn1 |
| InChI | InChI=1S/C19H27N5O2/c25-14-4-9-20-18-7-6-16(15-21-18)19(26)24-12-2-1-5-17(24)8-13-23-11-3-10-22-23/h3,6-7,10-11,15,17,25H,1-2,4-5,8-9,12-14H2,(H,20,21)/t17-/m1/s1 |
| InChIKey | TYPRIXLGWBAMEZ-QGZVFWFLSA-N |
| XLogP | 2.16 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|