C15H26N4O3 — CID 95202309
methyl 5-[4-ethyl-5-oxo-3-[(3R)-piperidin-3-yl]-1,2,4-triazol-1-yl]pentanoate (PubChem CID 95202309) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is methyl 5-[4-ethyl-5-oxo-3-[(3R)-piperidin-3-yl]-1,2,4-triazol-1-yl]pentanoate.
| Compound Name | methyl 5-[4-ethyl-5-oxo-3-[(3R)-piperidin-3-yl]-1,2,4-triazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 95202309 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | methyl 5-[4-ethyl-5-oxo-3-[(3R)-piperidin-3-yl]-1,2,4-triazol-1-yl]pentanoate |
| SMILES | CCn1c([C@@H]2CCCNC2)nn(CCCCC(=O)OC)c1=O |
| InChI | InChI=1S/C15H26N4O3/c1-3-18-14(12-7-6-9-16-11-12)17-19(15(18)21)10-5-4-8-13(20)22-2/h12,16H,3-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | DGSOLGCPNDBNFX-GFCCVEGCSA-N |
| XLogP | 0.88 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|