C13H23N7O3S — CID 95203259
4-[1-[[(3R)-piperidin-3-yl]methyl]triazole-4-carbonyl]piperazine-1-sulfonamide (PubChem CID 95203259) has the molecular formula C13H23N7O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 4-[1-[[(3R)-piperidin-3-yl]methyl]triazole-4-carbonyl]piperazine-1-sulfonamide.
| Compound Name | 4-[1-[[(3R)-piperidin-3-yl]methyl]triazole-4-carbonyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 95203259 |
| Molecular Formula | C13H23N7O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-[1-[[(3R)-piperidin-3-yl]methyl]triazole-4-carbonyl]piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(C(=O)c2cn(C[C@@H]3CCCNC3)nn2)CC1 |
| InChI | InChI=1S/C13H23N7O3S/c14-24(22,23)20-6-4-18(5-7-20)13(21)12-10-19(17-16-12)9-11-2-1-3-15-8-11/h10-11,15H,1-9H2,(H2,14,22,23)/t11-/m1/s1 |
| InChIKey | BJVCIPJHAJOVNO-LLVKDONJSA-N |
| XLogP | -1.76 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |