C19H23N5 — CID 95203761
4-cyclohexyl-1-[(1R)-2-imidazol-1-yl-1-phenylethyl]triazole (PubChem CID 95203761) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 4-cyclohexyl-1-[(1R)-2-imidazol-1-yl-1-phenylethyl]triazole.
| Compound Name | 4-cyclohexyl-1-[(1R)-2-imidazol-1-yl-1-phenylethyl]triazole |
|---|---|
| PubChem CID | 95203761 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 4-cyclohexyl-1-[(1R)-2-imidazol-1-yl-1-phenylethyl]triazole |
| SMILES | c1ccc([C@H](Cn2ccnc2)n2cc(C3CCCCC3)nn2)cc1 |
| InChI | InChI=1S/C19H23N5/c1-3-7-16(8-4-1)18-13-24(22-21-18)19(14-23-12-11-20-15-23)17-9-5-2-6-10-17/h2,5-6,9-13,15-16,19H,1,3-4,7-8,14H2/t19-/m0/s1 |
| InChIKey | BTZYLATZIQVQQC-IBGZPJMESA-N |
| XLogP | 3.81 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |