C17H26N4O2S — CID 95204092
(5R)-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione (PubChem CID 95204092) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is (5R)-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95204092 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (5R)-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-5-piperidin-4-yl-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@]1(C2CCNCC2)NC(=O)N(Cc2sc(C)nc2C)C1=O |
| InChI | InChI=1S/C17H26N4O2S/c1-4-7-17(13-5-8-18-9-6-13)15(22)21(16(23)20-17)10-14-11(2)19-12(3)24-14/h13,18H,4-10H2,1-3H3,(H,20,23)/t17-/m1/s1 |
| InChIKey | CINLYEYGYRCLBN-QGZVFWFLSA-N |
| XLogP | 2.35 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|