About 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one
5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one (PubChem CID 95205473) has the molecular formula C14H20N4O2S
and a molecular weight of 308.41 g/mol. Its IUPAC name is 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one |
| PubChem CID | 95205473 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one |
| SMILES | CSc1ncc(C(=O)N2CCC[C@]3(CCNC3)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H20N4O2S/c1-21-13-16-7-10(11(19)17-13)12(20)18-6-2-3-14(9-18)4-5-15-8-14/h7,15H,2-6,8-9H2,1H3,(H,16,17,19)/t14-/m1/s1 |
| InChIKey | KRUBREDYUHMEKW-CQSZACIVSA-N |
| XLogP | 0.71 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one?
The IUPAC name of 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one (CID 95205473) is 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one.
What is the SMILES notation for 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one?
The canonical SMILES for 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one is CSc1ncc(C(=O)N2CCC[C@]3(CCNC3)C2)c(=O)[nH]1.
What is the InChIKey of 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one?
The InChIKey is KRUBREDYUHMEKW-CQSZACIVSA-N. The full InChI is InChI=1S/C14H20N4O2S/c1-21-13-16-7-10(11(19)17-13)12(20)18-6-2-3-14(9-18)4-5-15-8-14/h7,15H,2-6,8-9H2,1H3,(H,16,17,19)/t14-/m1/s1.
What are the key properties of 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one?
5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one has a molecular weight of 308.41 g/mol, XLogP of 0.71, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5R)-2,7-diazaspiro[4.5]decane-7-carbonyl]-2-methylsulfanyl-1H-pyrimidin-6-one is sourced from PubChem (CID 95205473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).