C15H28N4 — CID 95205618
(1S)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3,3-dimethylcyclohexan-1-amine (PubChem CID 95205618) has the molecular formula C15H28N4 and a molecular weight of 264.42 g/mol. Its IUPAC name is (1S)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3,3-dimethylcyclohexan-1-amine.
| Compound Name | (1S)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3,3-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 95205618 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | (1S)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3,3-dimethylcyclohexan-1-amine |
| SMILES | Cc1nc(C)n(CCCN[C@H]2CCCC(C)(C)C2)n1 |
| InChI | InChI=1S/C15H28N4/c1-12-17-13(2)19(18-12)10-6-9-16-14-7-5-8-15(3,4)11-14/h14,16H,5-11H2,1-4H3/t14-/m0/s1 |
| InChIKey | PHBVTRAUEKTSOR-AWEZNQCLSA-N |
| XLogP | 2.84 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|