C20H21N5O3 — CID 95207303
N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-2-[(3S)-3-(4-phenyl-1H-pyrazol-5-yl)piperidin-1-yl]acetamide (PubChem CID 95207303) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-2-[(3S)-3-(4-phenyl-1H-pyrazol-5-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-2-[(3S)-3-(4-phenyl-1H-pyrazol-5-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 95207303 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-2-oxo-2-[(3S)-3-(4-phenyl-1H-pyrazol-5-yl)piperidin-1-yl]acetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2CCC[C@H](c3[nH]ncc3-c3ccccc3)C2)no1 |
| InChI | InChI=1S/C20H21N5O3/c1-13-10-17(24-28-13)22-19(26)20(27)25-9-5-8-15(12-25)18-16(11-21-23-18)14-6-3-2-4-7-14/h2-4,6-7,10-11,15H,5,8-9,12H2,1H3,(H,21,23)(H,22,24,26)/t15-/m0/s1 |
| InChIKey | VJYJVUZKXPLCJA-HNNXBMFYSA-N |
| XLogP | 2.72 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|