C13H21N3O3 — CID 95207705
(2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(hexanoylamino)acetic acid (PubChem CID 95207705) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(hexanoylamino)acetic acid.
| Compound Name | (2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(hexanoylamino)acetic acid |
|---|---|
| PubChem CID | 95207705 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(hexanoylamino)acetic acid |
| SMILES | CCCCCC(=O)N[C@H](C(=O)O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C13H21N3O3/c1-4-5-6-7-10(17)14-12(13(18)19)11-8(2)15-16-9(11)3/h12H,4-7H2,1-3H3,(H,14,17)(H,15,16)(H,18,19)/t12-/m0/s1 |
| InChIKey | RRBHTZLFFRVTES-LBPRGKRZSA-N |
| XLogP | 1.85 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|