C15H19N3O2 — CID 95208096
(5S)-5-[methyl(prop-2-ynyl)amino]-1-prop-2-enyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid (PubChem CID 95208096) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is (5S)-5-[methyl(prop-2-ynyl)amino]-1-prop-2-enyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid.
| Compound Name | (5S)-5-[methyl(prop-2-ynyl)amino]-1-prop-2-enyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 95208096 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (5S)-5-[methyl(prop-2-ynyl)amino]-1-prop-2-enyl-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| SMILES | C#CCN(C)[C@H]1CCc2c(c(C(=O)O)nn2CC=C)C1 |
| InChI | InChI=1S/C15H19N3O2/c1-4-8-17(3)11-6-7-13-12(10-11)14(15(19)20)16-18(13)9-5-2/h1,5,11H,2,6-10H2,3H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | KJFMMGYQWQAKHV-NSHDSACASA-N |
| XLogP | 1.19 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|