C22H26N4O — CID 95208575
2-tert-butyl-6-[[(4R)-4-pyridin-4-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]phenol (PubChem CID 95208575) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-tert-butyl-6-[[(4R)-4-pyridin-4-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]phenol.
| Compound Name | 2-tert-butyl-6-[[(4R)-4-pyridin-4-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 95208575 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-tert-butyl-6-[[(4R)-4-pyridin-4-yl-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]phenol |
| SMILES | CC(C)(C)c1cccc(CN2CCc3[nH]cnc3[C@H]2c2ccncc2)c1O |
| InChI | InChI=1S/C22H26N4O/c1-22(2,3)17-6-4-5-16(21(17)27)13-26-12-9-18-19(25-14-24-18)20(26)15-7-10-23-11-8-15/h4-8,10-11,14,20,27H,9,12-13H2,1-3H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | ILEKBWNEGKTEAS-HXUWFJFHSA-N |
| XLogP | 3.96 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|