C13H22N4O5S — CID 95209374
N-[2-[4-[(4R)-4-ethyl-2,5-dioxoimidazolidin-4-yl]piperidin-1-yl]-2-oxoethyl]methanesulfonamide (PubChem CID 95209374) has the molecular formula C13H22N4O5S and a molecular weight of 346.41 g/mol. Its IUPAC name is N-[2-[4-[(4R)-4-ethyl-2,5-dioxoimidazolidin-4-yl]piperidin-1-yl]-2-oxoethyl]methanesulfonamide.
| Compound Name | N-[2-[4-[(4R)-4-ethyl-2,5-dioxoimidazolidin-4-yl]piperidin-1-yl]-2-oxoethyl]methanesulfonamide |
|---|---|
| PubChem CID | 95209374 |
| Molecular Formula | C13H22N4O5S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N-[2-[4-[(4R)-4-ethyl-2,5-dioxoimidazolidin-4-yl]piperidin-1-yl]-2-oxoethyl]methanesulfonamide |
| SMILES | CC[C@]1(C2CCN(C(=O)CNS(C)(=O)=O)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C13H22N4O5S/c1-3-13(11(19)15-12(20)16-13)9-4-6-17(7-5-9)10(18)8-14-23(2,21)22/h9,14H,3-8H2,1-2H3,(H2,15,16,19,20)/t13-/m1/s1 |
| InChIKey | SOSOEJQTWHTBJN-CYBMUJFWSA-N |
| XLogP | -1.24 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|