C21H19FN4O2 — CID 95209428
1-[(3R)-3-[4-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-pyridin-3-ylethane-1,2-dione (PubChem CID 95209428) has the molecular formula C21H19FN4O2 and a molecular weight of 378.41 g/mol. Its IUPAC name is 1-[(3R)-3-[4-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-pyridin-3-ylethane-1,2-dione.
| Compound Name | 1-[(3R)-3-[4-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-pyridin-3-ylethane-1,2-dione |
|---|---|
| PubChem CID | 95209428 |
| Molecular Formula | C21H19FN4O2 |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-[(3R)-3-[4-(4-fluorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-pyridin-3-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCC[C@@H](c2[nH]ncc2-c2ccc(F)cc2)C1)c1cccnc1 |
| InChI | InChI=1S/C21H19FN4O2/c22-17-7-5-14(6-8-17)18-12-24-25-19(18)16-4-2-10-26(13-16)21(28)20(27)15-3-1-9-23-11-15/h1,3,5-9,11-12,16H,2,4,10,13H2,(H,24,25)/t16-/m1/s1 |
| InChIKey | XTXCBNYHMXAVTO-MRXNPFEDSA-N |
| XLogP | 3.20 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|