C16H16F2N2O4S2 — CID 95209585
2-[[(1S)-1-(3,5-difluorophenyl)ethyl]sulfamoyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid (PubChem CID 95209585) has the molecular formula C16H16F2N2O4S2 and a molecular weight of 402.44 g/mol. Its IUPAC name is 2-[[(1S)-1-(3,5-difluorophenyl)ethyl]sulfamoyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid.
| Compound Name | 2-[[(1S)-1-(3,5-difluorophenyl)ethyl]sulfamoyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 95209585 |
| Molecular Formula | C16H16F2N2O4S2 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2-[[(1S)-1-(3,5-difluorophenyl)ethyl]sulfamoyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid |
| SMILES | C[C@H](NS(=O)(=O)c1sc2c(c1C(=O)O)CCNC2)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H16F2N2O4S2/c1-8(9-4-10(17)6-11(18)5-9)20-26(23,24)16-14(15(21)22)12-2-3-19-7-13(12)25-16/h4-6,8,19-20H,2-3,7H2,1H3,(H,21,22)/t8-/m0/s1 |
| InChIKey | WBOQQTFITJLVHF-QMMMGPOBSA-N |
| XLogP | 2.41 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |