C22H32N6O — CID 95210227
(3R)-1-[2-[[2-(azocan-1-yl)-3-pyridinyl]methylamino]pyrimidin-4-yl]piperidin-3-ol (PubChem CID 95210227) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is (3R)-1-[2-[[2-(azocan-1-yl)-3-pyridinyl]methylamino]pyrimidin-4-yl]piperidin-3-ol.
| Compound Name | (3R)-1-[2-[[2-(azocan-1-yl)-3-pyridinyl]methylamino]pyrimidin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 95210227 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | (3R)-1-[2-[[2-(azocan-1-yl)-3-pyridinyl]methylamino]pyrimidin-4-yl]piperidin-3-ol |
| SMILES | O[C@@H]1CCCN(c2ccnc(NCc3cccnc3N3CCCCCCC3)n2)C1 |
| InChI | InChI=1S/C22H32N6O/c29-19-9-7-15-28(17-19)20-10-12-24-22(26-20)25-16-18-8-6-11-23-21(18)27-13-4-2-1-3-5-14-27/h6,8,10-12,19,29H,1-5,7,9,13-17H2,(H,24,25,26)/t19-/m1/s1 |
| InChIKey | LPRWFDBNYPJUAJ-LJQANCHMSA-N |
| XLogP | 3.22 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |