C20H22N2O3S — CID 95210293
(2S)-1-(9-hydroxy-7-pyridin-3-yl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-prop-2-enylsulfanylpropan-1-one (PubChem CID 95210293) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is (2S)-1-(9-hydroxy-7-pyridin-3-yl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-prop-2-enylsulfanylpropan-1-one.
| Compound Name | (2S)-1-(9-hydroxy-7-pyridin-3-yl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-prop-2-enylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 95210293 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2S)-1-(9-hydroxy-7-pyridin-3-yl-3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-prop-2-enylsulfanylpropan-1-one |
| SMILES | C=CCS[C@@H](C)C(=O)N1CCOc2c(O)cc(-c3cccnc3)cc2C1 |
| InChI | InChI=1S/C20H22N2O3S/c1-3-9-26-14(2)20(24)22-7-8-25-19-17(13-22)10-16(11-18(19)23)15-5-4-6-21-12-15/h3-6,10-12,14,23H,1,7-9,13H2,2H3/t14-/m0/s1 |
| InChIKey | OKGMLTCZGLWWJB-AWEZNQCLSA-N |
| XLogP | 3.48 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|