C18H23N7O2 — CID 95210694
(5R)-5-[1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]piperidin-4-yl]-5-pyridin-3-ylimidazolidine-2,4-dione (PubChem CID 95210694) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is (5R)-5-[1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]piperidin-4-yl]-5-pyridin-3-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]piperidin-4-yl]-5-pyridin-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95210694 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (5R)-5-[1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]piperidin-4-yl]-5-pyridin-3-ylimidazolidine-2,4-dione |
| SMILES | CCn1ncnc1CN1CCC([C@]2(c3cccnc3)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C18H23N7O2/c1-2-25-15(20-12-21-25)11-24-8-5-13(6-9-24)18(14-4-3-7-19-10-14)16(26)22-17(27)23-18/h3-4,7,10,12-13H,2,5-6,8-9,11H2,1H3,(H2,22,23,26,27)/t18-/m1/s1 |
| InChIKey | VOGWQKSDUKVMLC-GOSISDBHSA-N |
| XLogP | 0.64 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|