About (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane
(5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane (PubChem CID 95210934) has the molecular formula C16H26N4
and a molecular weight of 274.41 g/mol. Its IUPAC name is (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane |
| PubChem CID | 95210934 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane |
| SMILES | CCCc1cnc(C)nc1N1CCC[C@@]2(CCNC2)C1 |
| InChI | InChI=1S/C16H26N4/c1-3-5-14-10-18-13(2)19-15(14)20-9-4-6-16(12-20)7-8-17-11-16/h10,17H,3-9,11-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | ASHUFPDWCMPRJF-INIZCTEOSA-N |
| XLogP | 2.32 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane?
The IUPAC name of (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane (CID 95210934) is (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane.
What is the SMILES notation for (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane?
The canonical SMILES for (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane is CCCc1cnc(C)nc1N1CCC[C@@]2(CCNC2)C1.
What is the InChIKey of (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane?
The InChIKey is ASHUFPDWCMPRJF-INIZCTEOSA-N. The full InChI is InChI=1S/C16H26N4/c1-3-5-14-10-18-13(2)19-15(14)20-9-4-6-16(12-20)7-8-17-11-16/h10,17H,3-9,11-12H2,1-2H3/t16-/m0/s1.
What are the key properties of (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane?
(5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane has a molecular weight of 274.41 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-7-(2-methyl-5-propylpyrimidin-4-yl)-2,7-diazaspiro[4.5]decane is sourced from PubChem (CID 95210934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).