C17H22N2O4 — CID 95211055
(3S)-1-[2-methyl-5-(3-methylbutanoylamino)phenyl]-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 95211055) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is (3S)-1-[2-methyl-5-(3-methylbutanoylamino)phenyl]-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-1-[2-methyl-5-(3-methylbutanoylamino)phenyl]-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 95211055 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (3S)-1-[2-methyl-5-(3-methylbutanoylamino)phenyl]-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)CC(C)C)cc1N1C[C@@H](C(=O)O)CC1=O |
| InChI | InChI=1S/C17H22N2O4/c1-10(2)6-15(20)18-13-5-4-11(3)14(8-13)19-9-12(17(22)23)7-16(19)21/h4-5,8,10,12H,6-7,9H2,1-3H3,(H,18,20)(H,22,23)/t12-/m0/s1 |
| InChIKey | MDUZPFOXDAUGAF-LBPRGKRZSA-N |
| XLogP | 2.42 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |