C18H30N4O — CID 95211408
N-[[(3R)-1-[(1-ethylimidazol-2-yl)methyl]pyrrolidin-3-yl]methyl]cyclohexanecarboxamide (PubChem CID 95211408) has the molecular formula C18H30N4O and a molecular weight of 318.46 g/mol. Its IUPAC name is N-[[(3R)-1-[(1-ethylimidazol-2-yl)methyl]pyrrolidin-3-yl]methyl]cyclohexanecarboxamide.
| Compound Name | N-[[(3R)-1-[(1-ethylimidazol-2-yl)methyl]pyrrolidin-3-yl]methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 95211408 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | N-[[(3R)-1-[(1-ethylimidazol-2-yl)methyl]pyrrolidin-3-yl]methyl]cyclohexanecarboxamide |
| SMILES | CCn1ccnc1CN1CC[C@H](CNC(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C18H30N4O/c1-2-22-11-9-19-17(22)14-21-10-8-15(13-21)12-20-18(23)16-6-4-3-5-7-16/h9,11,15-16H,2-8,10,12-14H2,1H3,(H,20,23)/t15-/m1/s1 |
| InChIKey | PVHHYCOUFKNEBR-OAHLLOKOSA-N |
| XLogP | 2.42 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |